C16H13N3O4S — CID 159841173
[4-(1,3,5-triazin-2-yl)phenyl] 4-methoxybenzenesulfonate (PubChem CID 159841173) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is [4-(1,3,5-triazin-2-yl)phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-(1,3,5-triazin-2-yl)phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 159841173 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | [4-(1,3,5-triazin-2-yl)phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccc(-c3ncncn3)cc2)cc1 |
| InChI | InChI=1S/C16H13N3O4S/c1-22-13-6-8-15(9-7-13)24(20,21)23-14-4-2-12(3-5-14)16-18-10-17-11-19-16/h2-11H,1H3 |
| InChIKey | NORRFMUGCCPCLG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|