C21H34GeS2Si — CID 159870361
(7,10-dimethyl-7-octyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane (PubChem CID 159870361) has the molecular formula C21H34GeS2Si and a molecular weight of 451.33 g/mol. Its IUPAC name is (7,10-dimethyl-7-octyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane.
| Compound Name | (7,10-dimethyl-7-octyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 159870361 |
| Molecular Formula | C21H34GeS2Si |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (7,10-dimethyl-7-octyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane |
| SMILES | CCCCCCCC[Ge]1(C)c2cc(C)sc2-c2sc([Si](C)(C)C)cc21 |
| InChI | InChI=1S/C21H34GeS2Si/c1-7-8-9-10-11-12-13-22(3)17-14-16(2)23-20(17)21-18(22)15-19(24-21)25(4,5)6/h14-15H,7-13H2,1-6H3 |
| InChIKey | IAAMOFVIYPKOCG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|