C35H31NO — CID 159876270
bicyclo[2.2.2]octa-2,5-diene;phenanthren-3-amine;4-phenylbenzaldehyde (PubChem CID 159876270) has the molecular formula C35H31NO and a molecular weight of 481.64 g/mol. Its IUPAC name is bicyclo[2.2.2]octa-2,5-diene;phenanthren-3-amine;4-phenylbenzaldehyde.
| Compound Name | bicyclo[2.2.2]octa-2,5-diene;phenanthren-3-amine;4-phenylbenzaldehyde |
|---|---|
| PubChem CID | 159876270 |
| Molecular Formula | C35H31NO |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | bicyclo[2.2.2]octa-2,5-diene;phenanthren-3-amine;4-phenylbenzaldehyde |
| SMILES | C1=CC2C=CC1CC2.Nc1ccc2ccc3ccccc3c2c1.O=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11N.C13H10O.C8H10/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-2-8-5-3-7(1)4-6-8/h1-9H,15H2;1-10H;1-3,5,7-8H,4,6H2 |
| InChIKey | NSYDULOCNCOPOO-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|