About 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid
2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid (PubChem CID 159877854) has the molecular formula C11H16O4S3
and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid |
| PubChem CID | 159877854 |
| Molecular Formula | C11H16O4S3 |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccccc1S.OCCSSCCO |
| InChI | InChI=1S/C7H6O2S.C4H10O2S2/c8-7(9)5-3-1-2-4-6(5)10;5-1-3-7-8-4-2-6/h1-4,10H,(H,8,9);5-6H,1-4H2 |
| InChIKey | NTDGOEVOQWRWLM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid?
The IUPAC name of 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid (CID 159877854) is 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid.
What is the SMILES notation for 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid?
The canonical SMILES for 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid is O=C(O)c1ccccc1S.OCCSSCCO.
What is the InChIKey of 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid?
The InChIKey is NTDGOEVOQWRWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2S.C4H10O2S2/c8-7(9)5-3-1-2-4-6(5)10;5-1-3-7-8-4-2-6/h1-4,10H,(H,8,9);5-6H,1-4H2.
What are the key properties of 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid?
2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid has a molecular weight of 308.45 g/mol, XLogP of 2.03, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyldisulfanyl)ethanol;2-sulfanylbenzoic acid is sourced from PubChem (CID 159877854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).