C28H33ClN2O2 — CID 159928773
1-[(1S,3S)-3-butyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone (PubChem CID 159928773) has the molecular formula C28H33ClN2O2 and a molecular weight of 465.04 g/mol. Its IUPAC name is 1-[(1S,3S)-3-butyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone.
| Compound Name | 1-[(1S,3S)-3-butyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 159928773 |
| Molecular Formula | C28H33ClN2O2 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 1-[(1S,3S)-3-butyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone |
| SMILES | CCCC[C@H]1CC2=C(Cc3ccccc32)[C@H](c2ccc(N3CCOCC3)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C28H33ClN2O2/c1-2-3-7-23-18-25-24-8-5-4-6-21(24)17-26(25)28(31(23)27(32)19-29)20-9-11-22(12-10-20)30-13-15-33-16-14-30/h4-6,8-12,23,28H,2-3,7,13-19H2,1H3/t23-,28-/m0/s1 |
| InChIKey | NZJCBDUWDAMOFN-FIPFOOKPSA-N |
| XLogP | 5.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|