C23H24ClN3O2 — CID 159801977
(1S,3R)-1-(4-aminophenyl)-2-(2-chloroacetyl)-N,N-dimethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxamide (PubChem CID 159801977) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is (1S,3R)-1-(4-aminophenyl)-2-(2-chloroacetyl)-N,N-dimethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxamide.
| Compound Name | (1S,3R)-1-(4-aminophenyl)-2-(2-chloroacetyl)-N,N-dimethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 159801977 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (1S,3R)-1-(4-aminophenyl)-2-(2-chloroacetyl)-N,N-dimethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CC2=C(Cc3ccccc32)[C@H](c2ccc(N)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C23H24ClN3O2/c1-26(2)23(29)20-12-18-17-6-4-3-5-15(17)11-19(18)22(27(20)21(28)13-24)14-7-9-16(25)10-8-14/h3-10,20,22H,11-13,25H2,1-2H3/t20-,22+/m1/s1 |
| InChIKey | NJXIIQLOLMISFS-IRLDBZIGSA-N |
| XLogP | 3.25 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|