C26H27ClN2O — CID 147795156
1-[(1S,3S)-1-[4-(1-bicyclo[1.1.1]pentanylamino)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone (PubChem CID 147795156) has the molecular formula C26H27ClN2O and a molecular weight of 418.97 g/mol. Its IUPAC name is 1-[(1S,3S)-1-[4-(1-bicyclo[1.1.1]pentanylamino)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone.
| Compound Name | 1-[(1S,3S)-1-[4-(1-bicyclo[1.1.1]pentanylamino)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 147795156 |
| Molecular Formula | C26H27ClN2O |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[(1S,3S)-1-[4-(1-bicyclo[1.1.1]pentanylamino)phenyl]-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-2-chloroethanone |
| SMILES | C[C@H]1CC2=C(Cc3ccccc32)[C@H](c2ccc(NC34CC(C3)C4)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C26H27ClN2O/c1-16-10-22-21-5-3-2-4-19(21)11-23(22)25(29(16)24(30)15-27)18-6-8-20(9-7-18)28-26-12-17(13-26)14-26/h2-9,16-17,25,28H,10-15H2,1H3/t16-,17?,25-,26?/m0/s1 |
| InChIKey | HKKLYOZEHOLUNB-VFDSLNMKSA-N |
| XLogP | 5.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|