C21H20FNO — CID 160925573
1-[(1S,3S)-1-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]prop-2-yn-1-one (PubChem CID 160925573) has the molecular formula C21H20FNO and a molecular weight of 321.39 g/mol. Its IUPAC name is 1-[(1S,3S)-1-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(1S,3S)-1-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 160925573 |
| Molecular Formula | C21H20FNO |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[(1S,3S)-1-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1[C@@H](C)CC2=C(Cc3ccccc32)[C@@H]1C12CC(F)(C1)C2 |
| InChI | InChI=1S/C21H20FNO/c1-3-18(24)23-13(2)8-16-15-7-5-4-6-14(15)9-17(16)19(23)20-10-21(22,11-20)12-20/h1,4-7,13,19H,8-12H2,2H3/t13-,19+,20?,21?/m0/s1 |
| InChIKey | YZNCWVHIFIJGJC-IIRQWCSNSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|