C34H39ClN2O4 — CID 160788045
2-methoxyethyl (1S,3R)-1-[4-(1-adamantylamino)phenyl]-2-(2-chloroacetyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxylate (PubChem CID 160788045) has the molecular formula C34H39ClN2O4 and a molecular weight of 575.15 g/mol. Its IUPAC name is 2-methoxyethyl (1S,3R)-1-[4-(1-adamantylamino)phenyl]-2-(2-chloroacetyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxylate.
| Compound Name | 2-methoxyethyl (1S,3R)-1-[4-(1-adamantylamino)phenyl]-2-(2-chloroacetyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 160788045 |
| Molecular Formula | C34H39ClN2O4 |
| Molecular Weight | 575.15 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-methoxyethyl (1S,3R)-1-[4-(1-adamantylamino)phenyl]-2-(2-chloroacetyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridine-3-carboxylate |
| SMILES | COCCOC(=O)[C@H]1CC2=C(Cc3ccccc32)[C@H](c2ccc(NC34CC5CC(CC(C5)C3)C4)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C34H39ClN2O4/c1-40-10-11-41-33(39)30-16-28-27-5-3-2-4-25(27)15-29(28)32(37(30)31(38)20-35)24-6-8-26(9-7-24)36-34-17-21-12-22(18-34)14-23(13-21)19-34/h2-9,21-23,30,32,36H,10-20H2,1H3/t21?,22?,23?,30-,32+,34?/m1/s1 |
| InChIKey | SBLWLJZLDLANII-FKPAATTFSA-N |
| XLogP | 6.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.15 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|