C43H55N7O6 — CID 159930669
N-[3,5-bis[5-(diethylamino)pentanoyl]phenyl]-4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzamide (PubChem CID 159930669) has the molecular formula C43H55N7O6 and a molecular weight of 765.96 g/mol. Its IUPAC name is N-[3,5-bis[5-(diethylamino)pentanoyl]phenyl]-4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzamide.
| Compound Name | N-[3,5-bis[5-(diethylamino)pentanoyl]phenyl]-4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzamide |
|---|---|
| PubChem CID | 159930669 |
| Molecular Formula | C43H55N7O6 |
| Molecular Weight | 765.96 g/mol |
| Exact Mass | 765.42 |
| IUPAC Name | N-[3,5-bis[5-(diethylamino)pentanoyl]phenyl]-4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzamide |
| SMILES | CCN(CC)CCCCC(=O)c1cc(NC(=O)c2ccc(/N=N/C(C(C)=O)C(=O)Nc3ccc4c(c3)NC(=O)C4)cc2)cc(C(=O)CCCCN(CC)CC)c1 |
| InChI | InChI=1S/C43H55N7O6/c1-6-49(7-2)22-12-10-14-38(52)32-24-33(39(53)15-11-13-23-50(8-3)9-4)26-36(25-32)45-42(55)30-16-19-34(20-17-30)47-48-41(29(5)51)43(56)44-35-21-18-31-27-40(54)46-37(31)28-35/h16-21,24-26,28,41H,6-15,22-23,27H2,1-5H3,(H,44,56)(H,45,55)(H,46,54)/b48-47+ |
| InChIKey | WYNQQCYLLOBYBJ-QJGAVIKSSA-N |
| XLogP | 7.50 |
| TPSA | 169.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.96 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|