C34H31N5O9 — CID 160654467
3-[[4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzoyl]amino]-5-(5-prop-2-enoyloxypentanoyl)benzoic acid (PubChem CID 160654467) has the molecular formula C34H31N5O9 and a molecular weight of 653.65 g/mol. Its IUPAC name is 3-[[4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzoyl]amino]-5-(5-prop-2-enoyloxypentanoyl)benzoic acid.
| Compound Name | 3-[[4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzoyl]amino]-5-(5-prop-2-enoyloxypentanoyl)benzoic acid |
|---|---|
| PubChem CID | 160654467 |
| Molecular Formula | C34H31N5O9 |
| Molecular Weight | 653.65 g/mol |
| Exact Mass | 653.21 |
| IUPAC Name | 3-[[4-[[1,3-dioxo-1-[(2-oxo-1,3-dihydroindol-6-yl)amino]butan-2-yl]diazenyl]benzoyl]amino]-5-(5-prop-2-enoyloxypentanoyl)benzoic acid |
| SMILES | C=CC(=O)OCCCCC(=O)c1cc(NC(=O)c2ccc(/N=N/C(C(C)=O)C(=O)Nc3ccc4c(c3)NC(=O)C4)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C34H31N5O9/c1-3-30(43)48-13-5-4-6-28(41)22-14-23(34(46)47)16-26(15-22)36-32(44)20-7-10-24(11-8-20)38-39-31(19(2)40)33(45)35-25-12-9-21-17-29(42)37-27(21)18-25/h3,7-12,14-16,18,31H,1,4-6,13,17H2,2H3,(H,35,45)(H,36,44)(H,37,42)(H,46,47)/b39-38+ |
| InChIKey | BPLSGILFZALNLO-YMZYAJTMSA-N |
| XLogP | 4.89 |
| TPSA | 209.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|