C19H21Cl2NO5S — CID 159933246
(2S)-2-(benzylsulfonylamino)-3-phenylpropanoic acid;1,3-dichloropropan-2-one (PubChem CID 159933246) has the molecular formula C19H21Cl2NO5S and a molecular weight of 446.35 g/mol. Its IUPAC name is (2S)-2-(benzylsulfonylamino)-3-phenylpropanoic acid;1,3-dichloropropan-2-one.
| Compound Name | (2S)-2-(benzylsulfonylamino)-3-phenylpropanoic acid;1,3-dichloropropan-2-one |
|---|---|
| PubChem CID | 159933246 |
| Molecular Formula | C19H21Cl2NO5S |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | (2S)-2-(benzylsulfonylamino)-3-phenylpropanoic acid;1,3-dichloropropan-2-one |
| SMILES | O=C(CCl)CCl.O=C(O)[C@H](Cc1ccccc1)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO4S.C3H4Cl2O/c18-16(19)15(11-13-7-3-1-4-8-13)17-22(20,21)12-14-9-5-2-6-10-14;4-1-3(6)2-5/h1-10,15,17H,11-12H2,(H,18,19);1-2H2/t15-;/m0./s1 |
| InChIKey | NZXKNZLNGQEMMC-RSAXXLAASA-N |
| XLogP | 2.84 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|