C20H23NO3S — CID 154720321
N-[(2R)-3-oxo-1-phenylhept-6-en-2-yl]-1-phenylmethanesulfonamide (PubChem CID 154720321) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[(2R)-3-oxo-1-phenylhept-6-en-2-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(2R)-3-oxo-1-phenylhept-6-en-2-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 154720321 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[(2R)-3-oxo-1-phenylhept-6-en-2-yl]-1-phenylmethanesulfonamide |
| SMILES | C=CCCC(=O)[C@@H](Cc1ccccc1)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO3S/c1-2-3-14-20(22)19(15-17-10-6-4-7-11-17)21-25(23,24)16-18-12-8-5-9-13-18/h2,4-13,19,21H,1,3,14-16H2/t19-/m1/s1 |
| InChIKey | SQJJEKKBUFGKDE-LJQANCHMSA-N |
| XLogP | 3.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|