C35H34F2N2O7S2 — CID 171616798
N-[(2S,8S)-8-(benzylsulfonylamino)-4,6-difluoro-3,5,7-trioxo-1,9-diphenylnonan-2-yl]-1-phenylmethanesulfonamide (PubChem CID 171616798) has the molecular formula C35H34F2N2O7S2 and a molecular weight of 696.79 g/mol. Its IUPAC name is N-[(2S,8S)-8-(benzylsulfonylamino)-4,6-difluoro-3,5,7-trioxo-1,9-diphenylnonan-2-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(2S,8S)-8-(benzylsulfonylamino)-4,6-difluoro-3,5,7-trioxo-1,9-diphenylnonan-2-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 171616798 |
| Molecular Formula | C35H34F2N2O7S2 |
| Molecular Weight | 696.79 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | N-[(2S,8S)-8-(benzylsulfonylamino)-4,6-difluoro-3,5,7-trioxo-1,9-diphenylnonan-2-yl]-1-phenylmethanesulfonamide |
| SMILES | O=C(C(F)C(=O)[C@H](Cc1ccccc1)NS(=O)(=O)Cc1ccccc1)C(F)C(=O)[C@H](Cc1ccccc1)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C35H34F2N2O7S2/c36-31(33(40)29(21-25-13-5-1-6-14-25)38-47(43,44)23-27-17-9-3-10-18-27)35(42)32(37)34(41)30(22-26-15-7-2-8-16-26)39-48(45,46)24-28-19-11-4-12-20-28/h1-20,29-32,38-39H,21-24H2/t29-,30-,31?,32?/m0/s1 |
| InChIKey | WGMGQKRBWMXEHV-HWOSFROGSA-N |
| XLogP | 3.83 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|