C18H18N4O4 — CID 159936134
2-methyl-1,3-dihydroisoindol-4-amine;2-methyl-4-nitroisoindole-1,3-dione (PubChem CID 159936134) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-methyl-1,3-dihydroisoindol-4-amine;2-methyl-4-nitroisoindole-1,3-dione.
| Compound Name | 2-methyl-1,3-dihydroisoindol-4-amine;2-methyl-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 159936134 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-methyl-1,3-dihydroisoindol-4-amine;2-methyl-4-nitroisoindole-1,3-dione |
| SMILES | CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O.CN1Cc2cccc(N)c2C1 |
| InChI | InChI=1S/C9H6N2O4.C9H12N2/c1-10-8(12)5-3-2-4-6(11(14)15)7(5)9(10)13;1-11-5-7-3-2-4-9(10)8(7)6-11/h2-4H,1H3;2-4H,5-6,10H2,1H3 |
| InChIKey | OAGUIYYQCJLCEG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|