C24H34O — CID 159942553
(8R,9R,10S,13R,14S)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthrene;phenol (PubChem CID 159942553) has the molecular formula C24H34O and a molecular weight of 338.53 g/mol. Its IUPAC name is (8R,9R,10S,13R,14S)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthrene;phenol.
| Compound Name | (8R,9R,10S,13R,14S)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthrene;phenol |
|---|---|
| PubChem CID | 159942553 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (8R,9R,10S,13R,14S)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthrene;phenol |
| SMILES | C[C@@]12C=CC[C@H]1[C@@H]1CCC3CCCC[C@@H]3[C@H]1CC2.Oc1ccccc1 |
| InChI | InChI=1S/C18H28.C6H6O/c1-18-11-4-7-17(18)16-9-8-13-5-2-3-6-14(13)15(16)10-12-18;7-6-4-2-1-3-5-6/h4,11,13-17H,2-3,5-10,12H2,1H3;1-5,7H/t13?,14-,15+,16+,17-,18-;/m0./s1 |
| InChIKey | OBBJASAMHSHMKC-LBSXMSKVSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|