C17H15N3O4 — CID 159959810
6-amino-4H-1,4-benzoxazin-3-one;1H-indole-3-carboxylic acid (PubChem CID 159959810) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 6-amino-4H-1,4-benzoxazin-3-one;1H-indole-3-carboxylic acid.
| Compound Name | 6-amino-4H-1,4-benzoxazin-3-one;1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 159959810 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-amino-4H-1,4-benzoxazin-3-one;1H-indole-3-carboxylic acid |
| SMILES | Nc1ccc2c(c1)NC(=O)CO2.O=C(O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H7NO2.C8H8N2O2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8;9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-5,10H,(H,11,12);1-3H,4,9H2,(H,10,11) |
| InChIKey | ODELGMIAFQMTTA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|