C32H66O3 — CID 159966152
2-ethyl-3,4,5,6-tetramethyloxane;2-ethyl-3,4,5-trimethyloxolane;methane;2,3,4,5-tetramethylheptanal (PubChem CID 159966152) has the molecular formula C32H66O3 and a molecular weight of 498.88 g/mol. Its IUPAC name is 2-ethyl-3,4,5,6-tetramethyloxane;2-ethyl-3,4,5-trimethyloxolane;methane;2,3,4,5-tetramethylheptanal.
| Compound Name | 2-ethyl-3,4,5,6-tetramethyloxane;2-ethyl-3,4,5-trimethyloxolane;methane;2,3,4,5-tetramethylheptanal |
|---|---|
| PubChem CID | 159966152 |
| Molecular Formula | C32H66O3 |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.50 |
| IUPAC Name | 2-ethyl-3,4,5,6-tetramethyloxane;2-ethyl-3,4,5-trimethyloxolane;methane;2,3,4,5-tetramethylheptanal |
| SMILES | C.CCC(C)C(C)C(C)C(C)C=O.CCC1OC(C)C(C)C(C)C1C.CCC1OC(C)C(C)C1C |
| InChI | InChI=1S/2C11H22O.C9H18O.CH4/c1-6-11-9(4)7(2)8(3)10(5)12-11;1-6-8(2)10(4)11(5)9(3)7-12;1-5-9-7(3)6(2)8(4)10-9;/h2*7-11H,6H2,1-5H3;6-9H,5H2,1-4H3;1H4 |
| InChIKey | ODYNYKFMZIOCEG-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|