C20H21ClN2O6S — CID 159978901
2-[2-[4-[(5S)-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-2-oxo-1,3-oxazolidin-3-yl]anilino]ethoxy]acetic acid (PubChem CID 159978901) has the molecular formula C20H21ClN2O6S and a molecular weight of 452.92 g/mol. Its IUPAC name is 2-[2-[4-[(5S)-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-2-oxo-1,3-oxazolidin-3-yl]anilino]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[(5S)-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-2-oxo-1,3-oxazolidin-3-yl]anilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 159978901 |
| Molecular Formula | C20H21ClN2O6S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[2-[4-[(5S)-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-2-oxo-1,3-oxazolidin-3-yl]anilino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNc1ccc(N2C[C@H](CCC(=O)c3ccc(Cl)s3)OC2=O)cc1 |
| InChI | InChI=1S/C20H21ClN2O6S/c21-18-8-7-17(30-18)16(24)6-5-15-11-23(20(27)29-15)14-3-1-13(2-4-14)22-9-10-28-12-19(25)26/h1-4,7-8,15,22H,5-6,9-12H2,(H,25,26)/t15-/m0/s1 |
| InChIKey | FROLSDYYKPFGAB-HNNXBMFYSA-N |
| XLogP | 3.90 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|