C20H25ClN4O3S — CID 58256496
(5S)-3-[4-[amino-[2-(dimethylamino)ethyl]amino]phenyl]-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one (PubChem CID 58256496) has the molecular formula C20H25ClN4O3S and a molecular weight of 436.97 g/mol. Its IUPAC name is (5S)-3-[4-[amino-[2-(dimethylamino)ethyl]amino]phenyl]-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-[amino-[2-(dimethylamino)ethyl]amino]phenyl]-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58256496 |
| Molecular Formula | C20H25ClN4O3S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (5S)-3-[4-[amino-[2-(dimethylamino)ethyl]amino]phenyl]-5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one |
| SMILES | CN(C)CCN(N)c1ccc(N2C[C@H](CCC(=O)c3ccc(Cl)s3)OC2=O)cc1 |
| InChI | InChI=1S/C20H25ClN4O3S/c1-23(2)11-12-25(22)15-5-3-14(4-6-15)24-13-16(28-20(24)27)7-8-17(26)18-9-10-19(21)29-18/h3-6,9-10,16H,7-8,11-13,22H2,1-2H3/t16-/m0/s1 |
| InChIKey | WBUBBXHNADDZBF-INIZCTEOSA-N |
| XLogP | 3.63 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|