C43H54N6O7 — CID 159980918
3-[7-[[11-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]-10-oxoundecyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 159980918) has the molecular formula C43H54N6O7 and a molecular weight of 766.94 g/mol. Its IUPAC name is 3-[7-[[11-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]-10-oxoundecyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[11-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]-10-oxoundecyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 159980918 |
| Molecular Formula | C43H54N6O7 |
| Molecular Weight | 766.94 g/mol |
| Exact Mass | 766.41 |
| IUPAC Name | 3-[7-[[11-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]-10-oxoundecyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3c2ccn3C)cc(OC)c1CN(C)CC(=O)CCCCCCCCCNc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C43H54N6O7/c1-46(25-34-37(55-4)22-28(23-38(34)56-5)32-26-48(3)43(54)40-30(32)19-21-47(40)2)24-29(50)14-11-9-7-6-8-10-12-20-44-35-16-13-15-31-33(35)27-49(42(31)53)36-17-18-39(51)45-41(36)52/h13,15-16,19,21-23,26,36,44H,6-12,14,17-18,20,24-25,27H2,1-5H3,(H,45,51,52) |
| InChIKey | OFTIHWYLSJJBFA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.94 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|