About methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine
methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine (PubChem CID 159997782) has the molecular formula C21H28N2
and a molecular weight of 308.47 g/mol. Its IUPAC name is methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine |
| PubChem CID | 159997782 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine |
| SMILES | CC1CCCCC1.Nc1cccc(N)c1C=Cc1ccccc1 |
| InChI | InChI=1S/C14H14N2.C7H14/c15-13-7-4-8-14(16)12(13)10-9-11-5-2-1-3-6-11;1-7-5-3-2-4-6-7/h1-10H,15-16H2;7H,2-6H2,1H3 |
| InChIKey | OHTNIUKJLUOFCW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine?
The IUPAC name of methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine (CID 159997782) is methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine.
What is the SMILES notation for methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine?
The canonical SMILES for methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine is CC1CCCCC1.Nc1cccc(N)c1C=Cc1ccccc1.
What is the InChIKey of methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine?
The InChIKey is OHTNIUKJLUOFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2.C7H14/c15-13-7-4-8-14(16)12(13)10-9-11-5-2-1-3-6-11;1-7-5-3-2-4-6-7/h1-10H,15-16H2;7H,2-6H2,1H3.
What are the key properties of methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine?
methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine has a molecular weight of 308.47 g/mol, XLogP of 5.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclohexane;2-(2-phenylethenyl)benzene-1,3-diamine is sourced from PubChem (CID 159997782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).