C35H36BBr2F3N2O6S2 — CID 159999527
4-bromo-1-ethylsulfonyl-6-fluoroindole;4-bromo-6-fluoro-1H-indene;1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 159999527) has the molecular formula C35H36BBr2F3N2O6S2 and a molecular weight of 872.43 g/mol. Its IUPAC name is 4-bromo-1-ethylsulfonyl-6-fluoroindole;4-bromo-6-fluoro-1H-indene;1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 4-bromo-1-ethylsulfonyl-6-fluoroindole;4-bromo-6-fluoro-1H-indene;1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 159999527 |
| Molecular Formula | C35H36BBr2F3N2O6S2 |
| Molecular Weight | 872.43 g/mol |
| Exact Mass | 870.04 |
| IUPAC Name | 4-bromo-1-ethylsulfonyl-6-fluoroindole;4-bromo-6-fluoro-1H-indene;1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CCS(=O)(=O)n1ccc2c(B3OC(C)(C)C(C)(C)O3)cc(F)cc21.CCS(=O)(=O)n1ccc2c(Br)cc(F)cc21.Fc1cc(Br)c2c(c1)CC=C2 |
| InChI | InChI=1S/C16H21BFNO4S.C10H9BrFNO2S.C9H6BrF/c1-6-24(20,21)19-8-7-12-13(9-11(18)10-14(12)19)17-22-15(2,3)16(4,5)23-17;1-2-16(14,15)13-4-3-8-9(11)5-7(12)6-10(8)13;10-9-5-7(11)4-6-2-1-3-8(6)9/h7-10H,6H2,1-5H3;3-6H,2H2,1H3;1,3-5H,2H2 |
| InChIKey | OHZHPASCRINONO-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.43 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|