About butanamide;1,3-dimethylimidazolidin-4-one
butanamide;1,3-dimethylimidazolidin-4-one (PubChem CID 160503193) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is butanamide;1,3-dimethylimidazolidin-4-one.
Molecular Properties
| Compound Name | butanamide;1,3-dimethylimidazolidin-4-one |
| PubChem CID | 160503193 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | butanamide;1,3-dimethylimidazolidin-4-one |
| SMILES | CCCC(N)=O.CN1CC(=O)N(C)C1 |
| InChI | InChI=1S/C5H10N2O.C4H9NO/c1-6-3-5(8)7(2)4-6;1-2-3-4(5)6/h3-4H2,1-2H3;2-3H2,1H3,(H2,5,6) |
| InChIKey | QSBCIDXNPSRPSA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butanamide;1,3-dimethylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;1,3-dimethylimidazolidin-4-one?
The IUPAC name of butanamide;1,3-dimethylimidazolidin-4-one (CID 160503193) is butanamide;1,3-dimethylimidazolidin-4-one.
What is the SMILES notation for butanamide;1,3-dimethylimidazolidin-4-one?
The canonical SMILES for butanamide;1,3-dimethylimidazolidin-4-one is CCCC(N)=O.CN1CC(=O)N(C)C1.
What is the InChIKey of butanamide;1,3-dimethylimidazolidin-4-one?
The InChIKey is QSBCIDXNPSRPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.C4H9NO/c1-6-3-5(8)7(2)4-6;1-2-3-4(5)6/h3-4H2,1-2H3;2-3H2,1H3,(H2,5,6).
What are the key properties of butanamide;1,3-dimethylimidazolidin-4-one?
butanamide;1,3-dimethylimidazolidin-4-one has a molecular weight of 201.27 g/mol, XLogP of -0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;1,3-dimethylimidazolidin-4-one is sourced from PubChem (CID 160503193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).