C23H42NO3+ — CID 160510363
9-hydroxy-8-methyl-7-oxa-9-azoniatricyclo[7.3.1.01,6]tridecane;(5S)-spiro[5.5]undecan-5-ol (PubChem CID 160510363) has the molecular formula C23H42NO3+ and a molecular weight of 380.59 g/mol. Its IUPAC name is 9-hydroxy-8-methyl-7-oxa-9-azoniatricyclo[7.3.1.01,6]tridecane;(5S)-spiro[5.5]undecan-5-ol.
| Compound Name | 9-hydroxy-8-methyl-7-oxa-9-azoniatricyclo[7.3.1.01,6]tridecane;(5S)-spiro[5.5]undecan-5-ol |
|---|---|
| PubChem CID | 160510363 |
| Molecular Formula | C23H42NO3+ |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | 9-hydroxy-8-methyl-7-oxa-9-azoniatricyclo[7.3.1.01,6]tridecane;(5S)-spiro[5.5]undecan-5-ol |
| SMILES | CC1OC2CCCCC23CCC[N+]1(O)C3.O[C@H]1CCCCC12CCCCC2 |
| InChI | InChI=1S/C12H22NO2.C11H20O/c1-10-13(14)8-4-7-12(9-13)6-3-2-5-11(12)15-10;12-10-6-2-5-9-11(10)7-3-1-4-8-11/h10-11,14H,2-9H2,1H3;10,12H,1-9H2/q+1;/t;10-/m.0/s1 |
| InChIKey | YCTUSPAUJXMSRV-CICJTZRQSA-N |
| XLogP | 5.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|