C26H32N6O — CID 160525972
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[4-(2H-triazol-4-yl)phenyl]piperidine-3-carboxamide (PubChem CID 160525972) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[4-(2H-triazol-4-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[4-(2H-triazol-4-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 160525972 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[4-(2H-triazol-4-yl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)C1CCCN(c2ccc(-c3cn[nH]n3)cc2)C1 |
| InChI | InChI=1S/C26H32N6O/c33-26(27-13-4-14-31-16-12-20-5-1-2-6-22(20)18-31)23-7-3-15-32(19-23)24-10-8-21(9-11-24)25-17-28-30-29-25/h1-2,5-6,8-11,17,23H,3-4,7,12-16,18-19H2,(H,27,33)(H,28,29,30) |
| InChIKey | KREHCOJRSKTKLX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|