C21H37N3O10S — CID 160540223
methyl 2-(2-methoxy-2-oxoethyl)sulfanylacetate;1,3,5-tris(2-hydroxybutyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 160540223) has the molecular formula C21H37N3O10S and a molecular weight of 523.61 g/mol. Its IUPAC name is methyl 2-(2-methoxy-2-oxoethyl)sulfanylacetate;1,3,5-tris(2-hydroxybutyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | methyl 2-(2-methoxy-2-oxoethyl)sulfanylacetate;1,3,5-tris(2-hydroxybutyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 160540223 |
| Molecular Formula | C21H37N3O10S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | methyl 2-(2-methoxy-2-oxoethyl)sulfanylacetate;1,3,5-tris(2-hydroxybutyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCC(O)Cn1c(=O)n(CC(O)CC)c(=O)n(CC(O)CC)c1=O.COC(=O)CSCC(=O)OC |
| InChI | InChI=1S/C15H27N3O6.C6H10O4S/c1-4-10(19)7-16-13(22)17(8-11(20)5-2)15(24)18(14(16)23)9-12(21)6-3;1-9-5(7)3-11-4-6(8)10-2/h10-12,19-21H,4-9H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | QWRLXTAVAXTADI-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 179.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |