C39H60O5 — CID 160559299
4-butan-2-ylphenol;(4-butan-2-ylphenyl) acetate;(2-ethyl-2-bicyclo[3.3.1]nonanyl) 2,2-dimethylbutanoate (PubChem CID 160559299) has the molecular formula C39H60O5 and a molecular weight of 608.90 g/mol. Its IUPAC name is 4-butan-2-ylphenol;(4-butan-2-ylphenyl) acetate;(2-ethyl-2-bicyclo[3.3.1]nonanyl) 2,2-dimethylbutanoate.
| Compound Name | 4-butan-2-ylphenol;(4-butan-2-ylphenyl) acetate;(2-ethyl-2-bicyclo[3.3.1]nonanyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 160559299 |
| Molecular Formula | C39H60O5 |
| Molecular Weight | 608.90 g/mol |
| Exact Mass | 608.44 |
| IUPAC Name | 4-butan-2-ylphenol;(4-butan-2-ylphenyl) acetate;(2-ethyl-2-bicyclo[3.3.1]nonanyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(CC)CCC2CCCC1C2.CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C17H30O2.C12H16O2.C10H14O/c1-5-16(3,4)15(18)19-17(6-2)11-10-13-8-7-9-14(17)12-13;1-4-9(2)11-5-7-12(8-6-11)14-10(3)13;1-3-8(2)9-4-6-10(11)7-5-9/h13-14H,5-12H2,1-4H3;5-9H,4H2,1-3H3;4-8,11H,3H2,1-2H3 |
| InChIKey | QZCDBHDBOSYRAH-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.90 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|