C9H12I2NY- — CID 160583034
molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium (PubChem CID 160583034) has the molecular formula C9H12I2NY- and a molecular weight of 476.92 g/mol. Its IUPAC name is molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium.
| Compound Name | molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 160583034 |
| Molecular Formula | C9H12I2NY- |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.81 |
| IUPAC Name | molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium |
| SMILES | Cc1[c-]nc(C)c(C)c1C.II.[Y] |
| InChI | InChI=1S/C9H12N.I2.Y/c1-6-5-10-9(4)8(3)7(6)2;1-2;/h1-4H3;;/q-1;; |
| InChIKey | HGUJVIIBXRMNTI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|