molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium

C9H12I2NY- — CID 160583034

IUPACmolecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium
SMILESCc1[c-]nc(C)c(C)c1C.II.[Y]
InChIInChI=1S/C9H12N.I2.Y/c1-6-5-10-9(4)8(3)7(6)2;1-2;/h1-4H3;;/q-1;;
InChIKeyHGUJVIIBXRMNTI-UHFFFAOYSA-N
MW476.92 g/mol
LogP3.88
Rot. Bonds

About molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium

molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium (PubChem CID 160583034) has the molecular formula C9H12I2NY- and a molecular weight of 476.92 g/mol. Its IUPAC name is molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium.

Molecular Properties

Compound Namemolecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium
PubChem CID160583034
Molecular FormulaC9H12I2NY-
Molecular Weight476.92 g/mol
Exact Mass476.81
IUPAC Namemolecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium
SMILESCc1[c-]nc(C)c(C)c1C.II.[Y]
InChIInChI=1S/C9H12N.I2.Y/c1-6-5-10-9(4)8(3)7(6)2;1-2;/h1-4H3;;/q-1;;
InChIKeyHGUJVIIBXRMNTI-UHFFFAOYSA-N
XLogP3.88
TPSA12.89 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500476.92
LogP ≤ 53.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium?
The IUPAC name of molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium (CID 160583034) is molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium.
What is the SMILES notation for molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium?
The canonical SMILES for molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium is Cc1[c-]nc(C)c(C)c1C.II.[Y].
What is the InChIKey of molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium?
The InChIKey is HGUJVIIBXRMNTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.I2.Y/c1-6-5-10-9(4)8(3)7(6)2;1-2;/h1-4H3;;/q-1;;.
What are the key properties of molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium?
molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium has a molecular weight of 476.92 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium is sourced from PubChem (CID 160583034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).