About aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene
aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene (PubChem CID 160589758) has the molecular formula C30H24Br3IN2
and a molecular weight of 779.15 g/mol. Its IUPAC name is aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene.
Molecular Properties
| Compound Name | aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene |
| PubChem CID | 160589758 |
| Molecular Formula | C30H24Br3IN2 |
| Molecular Weight | 779.15 g/mol |
| Exact Mass | 775.85 |
| IUPAC Name | aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene |
| SMILES | Brc1ccc(I)cc1.Brc1ccc(N(c2ccccc2)c2ccc(Br)cc2)cc1.Nc1ccccc1 |
| InChI | InChI=1S/C18H13Br2N.C6H4BrI.C6H7N/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18;7-5-1-3-6(8)4-2-5;7-6-4-2-1-3-5-6/h1-13H;1-4H;1-5H,7H2 |
| InChIKey | RCVWJKHKUXFWMZ-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 779.15 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene?
The IUPAC name of aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene (CID 160589758) is aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene.
What is the SMILES notation for aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene?
The canonical SMILES for aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene is Brc1ccc(I)cc1.Brc1ccc(N(c2ccccc2)c2ccc(Br)cc2)cc1.Nc1ccccc1.
What is the InChIKey of aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene?
The InChIKey is RCVWJKHKUXFWMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Br2N.C6H4BrI.C6H7N/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18;7-5-1-3-6(8)4-2-5;7-6-4-2-1-3-5-6/h1-13H;1-4H;1-5H,7H2.
What are the key properties of aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene?
aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene has a molecular weight of 779.15 g/mol, XLogP of 11.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;4-bromo-N-(4-bromophenyl)-N-phenylaniline;1-bromo-4-iodobenzene is sourced from PubChem (CID 160589758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).