C23H27N7O2 — CID 160615031
N-hydroxy-6-[2-[(1S)-1-(1H-imidazo[4,5-c]pyridin-4-ylamino)propyl]quinazolin-4-yl]hexanamide (PubChem CID 160615031) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-hydroxy-6-[2-[(1S)-1-(1H-imidazo[4,5-c]pyridin-4-ylamino)propyl]quinazolin-4-yl]hexanamide.
| Compound Name | N-hydroxy-6-[2-[(1S)-1-(1H-imidazo[4,5-c]pyridin-4-ylamino)propyl]quinazolin-4-yl]hexanamide |
|---|---|
| PubChem CID | 160615031 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-hydroxy-6-[2-[(1S)-1-(1H-imidazo[4,5-c]pyridin-4-ylamino)propyl]quinazolin-4-yl]hexanamide |
| SMILES | CC[C@H](Nc1nccc2[nH]cnc12)c1nc(CCCCCC(=O)NO)c2ccccc2n1 |
| InChI | InChI=1S/C23H27N7O2/c1-2-16(27-23-21-19(12-13-24-23)25-14-26-21)22-28-17(9-4-3-5-11-20(31)30-32)15-8-6-7-10-18(15)29-22/h6-8,10,12-14,16,32H,2-5,9,11H2,1H3,(H,24,27)(H,25,26)(H,30,31)/t16-/m0/s1 |
| InChIKey | GCDVPXGQSOQFNM-INIZCTEOSA-N |
| XLogP | 4.07 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|