C15H28N2O7 — CID 160617096
(2S)-4-methyl-2-(methylamino)pentanoic acid;2-oxopropanoic acid;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 160617096) has the molecular formula C15H28N2O7 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2S)-4-methyl-2-(methylamino)pentanoic acid;2-oxopropanoic acid;(2S)-pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-methyl-2-(methylamino)pentanoic acid;2-oxopropanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 160617096 |
| Molecular Formula | C15H28N2O7 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (2S)-4-methyl-2-(methylamino)pentanoic acid;2-oxopropanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)C(=O)O.CN[C@@H](CC(C)C)C(=O)O.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C7H15NO2.C5H9NO2.C3H4O3/c1-5(2)4-6(8-3)7(9)10;7-5(8)4-2-1-3-6-4;1-2(4)3(5)6/h5-6,8H,4H2,1-3H3,(H,9,10);4,6H,1-3H2,(H,7,8);1H3,(H,5,6)/t6-;4-;/m00./s1 |
| InChIKey | RGFUHHBKVZJUHI-JQFBFHSRSA-N |
| XLogP | 0.19 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|