C9H18N2O4 — CID 19842151
2-(methylamino)propanoic acid;pyrrolidine-2-carboxylic acid (PubChem CID 19842151) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-(methylamino)propanoic acid;pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(methylamino)propanoic acid;pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19842151 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-(methylamino)propanoic acid;pyrrolidine-2-carboxylic acid |
| SMILES | CNC(C)C(=O)O.O=C(O)C1CCCN1 |
| InChI | InChI=1S/C5H9NO2.C4H9NO2/c7-5(8)4-2-1-3-6-4;1-3(5-2)4(6)7/h4,6H,1-3H2,(H,7,8);3,5H,1-2H3,(H,6,7) |
| InChIKey | HILRXJOUKBYESU-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |