C15H26N2O7 — CID 69350419
(2S)-2-[(2-carboxy-2-oxoethyl)-methylamino]-4-methylpentanoic acid;pyrrolidine-2-carboxylic acid (PubChem CID 69350419) has the molecular formula C15H26N2O7 and a molecular weight of 346.38 g/mol. Its IUPAC name is (2S)-2-[(2-carboxy-2-oxoethyl)-methylamino]-4-methylpentanoic acid;pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-2-[(2-carboxy-2-oxoethyl)-methylamino]-4-methylpentanoic acid;pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69350419 |
| Molecular Formula | C15H26N2O7 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2S)-2-[(2-carboxy-2-oxoethyl)-methylamino]-4-methylpentanoic acid;pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)CC(=O)C(=O)O.O=C(O)C1CCCN1 |
| InChI | InChI=1S/C10H17NO5.C5H9NO2/c1-6(2)4-7(9(13)14)11(3)5-8(12)10(15)16;7-5(8)4-2-1-3-6-4/h6-7H,4-5H2,1-3H3,(H,13,14)(H,15,16);4,6H,1-3H2,(H,7,8)/t7-;/m0./s1 |
| InChIKey | XXHGUQMOBFWHMW-FJXQXJEOSA-N |
| XLogP | -0.11 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|