C38H30F12N4O3 — CID 160656897
2-[4-[(5-aminoindol-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]acetamide (PubChem CID 160656897) has the molecular formula C38H30F12N4O3 and a molecular weight of 818.66 g/mol. Its IUPAC name is 2-[4-[(5-aminoindol-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]acetamide.
| Compound Name | 2-[4-[(5-aminoindol-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]acetamide |
|---|---|
| PubChem CID | 160656897 |
| Molecular Formula | C38H30F12N4O3 |
| Molecular Weight | 818.66 g/mol |
| Exact Mass | 818.21 |
| IUPAC Name | 2-[4-[(5-aminoindol-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(ccn2Cc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c1.Nc1ccc2c(ccn2Cc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H16F6N2O2.C18H14F6N2O/c1-12(29)27-16-6-7-17-14(10-16)8-9-28(17)11-13-2-4-15(5-3-13)18(30,19(21,22)23)20(24,25)26;19-17(20,21)16(27,18(22,23)24)13-3-1-11(2-4-13)10-26-8-7-12-9-14(25)5-6-15(12)26/h2-10,30H,11H2,1H3,(H,27,29);1-9,27H,10,25H2 |
| InChIKey | RLEAGIPOISJCGQ-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.66 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|