C31H45F5O10S2 — CID 160658517
4-butan-2-ylbenzenesulfonic acid;2-(2-butan-2-yloxyethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 160658517) has the molecular formula C31H45F5O10S2 and a molecular weight of 736.81 g/mol. Its IUPAC name is 4-butan-2-ylbenzenesulfonic acid;2-(2-butan-2-yloxyethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 4-butan-2-ylbenzenesulfonic acid;2-(2-butan-2-yloxyethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 160658517 |
| Molecular Formula | C31H45F5O10S2 |
| Molecular Weight | 736.81 g/mol |
| Exact Mass | 736.24 |
| IUPAC Name | 4-butan-2-ylbenzenesulfonic acid;2-(2-butan-2-yloxyethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCC(C)OCCOC(=O)C(F)(F)S(=O)(=O)O.CCC(C)c1ccc(C(C)(O)C(F)(F)F)cc1.CCC(C)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H17F3O.C10H14O3S.C8H14F2O6S/c1-4-9(2)10-5-7-11(8-6-10)12(3,17)13(14,15)16;1-3-8(2)9-4-6-10(7-5-9)14(11,12)13;1-3-6(2)15-4-5-16-7(11)8(9,10)17(12,13)14/h5-9,17H,4H2,1-3H3;4-8H,3H2,1-2H3,(H,11,12,13);6H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | RLJBQMMBOLPXEU-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.81 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|