C45H57NO10S3 — CID 160662121
1-butan-2-ylsulfonyl-4-pent-3-ynylbenzene;2-(4-but-2-ynylphenyl)sulfonyl-N-hydroxy-2-methylbutanamide;2-(4-but-2-ynylphenyl)sulfonyl-2-methylbutanoic acid (PubChem CID 160662121) has the molecular formula C45H57NO10S3 and a molecular weight of 868.15 g/mol. Its IUPAC name is 1-butan-2-ylsulfonyl-4-pent-3-ynylbenzene;2-(4-but-2-ynylphenyl)sulfonyl-N-hydroxy-2-methylbutanamide;2-(4-but-2-ynylphenyl)sulfonyl-2-methylbutanoic acid.
| Compound Name | 1-butan-2-ylsulfonyl-4-pent-3-ynylbenzene;2-(4-but-2-ynylphenyl)sulfonyl-N-hydroxy-2-methylbutanamide;2-(4-but-2-ynylphenyl)sulfonyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 160662121 |
| Molecular Formula | C45H57NO10S3 |
| Molecular Weight | 868.15 g/mol |
| Exact Mass | 867.31 |
| IUPAC Name | 1-butan-2-ylsulfonyl-4-pent-3-ynylbenzene;2-(4-but-2-ynylphenyl)sulfonyl-N-hydroxy-2-methylbutanamide;2-(4-but-2-ynylphenyl)sulfonyl-2-methylbutanoic acid |
| SMILES | CC#CCCc1ccc(S(=O)(=O)C(C)CC)cc1.CC#CCc1ccc(S(=O)(=O)C(C)(CC)C(=O)NO)cc1.CC#CCc1ccc(S(=O)(=O)C(C)(CC)C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO4S.C15H18O4S.C15H20O2S/c1-4-6-7-12-8-10-13(11-9-12)21(19,20)15(3,5-2)14(17)16-18;1-4-6-7-12-8-10-13(11-9-12)20(18,19)15(3,5-2)14(16)17;1-4-6-7-8-14-9-11-15(12-10-14)18(16,17)13(3)5-2/h8-11,18H,5,7H2,1-3H3,(H,16,17);8-11H,5,7H2,1-3H3,(H,16,17);9-13H,5,7-8H2,1-3H3 |
| InChIKey | RLUSLNUXWCHOCR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 189.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.15 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|