C24H32N2O10 — CID 160670689
tert-butyl N-[3-(3-butoxy-4-nitrophenyl)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 160670689) has the molecular formula C24H32N2O10 and a molecular weight of 508.52 g/mol. Its IUPAC name is tert-butyl N-[3-(3-butoxy-4-nitrophenyl)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(3-butoxy-4-nitrophenyl)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 160670689 |
| Molecular Formula | C24H32N2O10 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | tert-butyl N-[3-(3-butoxy-4-nitrophenyl)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCOc1cc(CC(NC(=O)OC(C)(C)C)C(=O)C2C(=O)OC(C)(C)OC2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H32N2O10/c1-7-8-11-33-17-13-14(9-10-16(17)26(31)32)12-15(25-22(30)36-23(2,3)4)19(27)18-20(28)34-24(5,6)35-21(18)29/h9-10,13,15,18H,7-8,11-12H2,1-6H3,(H,25,30) |
| InChIKey | RMWUQQDTQAGJOD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|