C19H29NO9 — CID 70252791
butyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 70252791) has the molecular formula C19H29NO9 and a molecular weight of 415.44 g/mol. Its IUPAC name is butyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | butyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 70252791 |
| Molecular Formula | C19H29NO9 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | butyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | CCCCOC(=O)[C@H](CC(=O)C1C(=O)OC(C)(C)OC1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29NO9/c1-7-8-9-26-14(22)11(20-17(25)29-18(2,3)4)10-12(21)13-15(23)27-19(5,6)28-16(13)24/h11,13H,7-10H2,1-6H3,(H,20,25)/t11-/m0/s1 |
| InChIKey | NCFBEFBPKPWXKO-NSHDSACASA-N |
| XLogP | 1.63 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|