C22H29NO8 — CID 11048359
benzyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 11048359) has the molecular formula C22H29NO8 and a molecular weight of 435.47 g/mol. Its IUPAC name is benzyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 11048359 |
| Molecular Formula | C22H29NO8 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | benzyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC1C(=O)OC(C)(C)OC1=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29NO8/c1-21(2,3)31-20(27)23-16(19(26)28-13-14-9-7-6-8-10-14)12-11-15-17(24)29-22(4,5)30-18(15)25/h6-10,15-16H,11-13H2,1-5H3,(H,23,27)/t16-/m0/s1 |
| InChIKey | IRGNOKDWJQIUAE-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|