C17H22Cl3NO9 — CID 10907114
2,2,2-trichloroethyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 10907114) has the molecular formula C17H22Cl3NO9 and a molecular weight of 490.72 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | 2,2,2-trichloroethyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 10907114 |
| Molecular Formula | C17H22Cl3NO9 |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 2,2,2-trichloroethyl (2S)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)C1C(=O)OC(C)(C)OC1=O)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H22Cl3NO9/c1-15(2,3)30-14(26)21-8(11(23)27-7-17(18,19)20)6-9(22)10-12(24)28-16(4,5)29-13(10)25/h8,10H,6-7H2,1-5H3,(H,21,26)/t8-/m0/s1 |
| InChIKey | QUPPKFKJLJXXEV-QMMMGPOBSA-N |
| XLogP | 2.20 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|