C27H24ClF6N3O4S — CID 160690840
bis[[3-(trifluoromethyl)phenyl]methyl] (1R,2S,4S,5R,6R)-2-amino-4-(4H-imidazol-2-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride (PubChem CID 160690840) has the molecular formula C27H24ClF6N3O4S and a molecular weight of 636.01 g/mol. Its IUPAC name is bis[[3-(trifluoromethyl)phenyl]methyl] (1R,2S,4S,5R,6R)-2-amino-4-(4H-imidazol-2-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride.
| Compound Name | bis[[3-(trifluoromethyl)phenyl]methyl] (1R,2S,4S,5R,6R)-2-amino-4-(4H-imidazol-2-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 160690840 |
| Molecular Formula | C27H24ClF6N3O4S |
| Molecular Weight | 636.01 g/mol |
| Exact Mass | 635.11 |
| IUPAC Name | bis[[3-(trifluoromethyl)phenyl]methyl] (1R,2S,4S,5R,6R)-2-amino-4-(4H-imidazol-2-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride |
| SMILES | Cl.N[C@@]1(C(=O)OCc2cccc(C(F)(F)F)c2)C[C@H](SC2=NCC=N2)[C@H]2[C@H](C(=O)OCc3cccc(C(F)(F)F)c3)[C@H]21 |
| InChI | InChI=1S/C27H23F6N3O4S.ClH/c28-26(29,30)16-5-1-3-14(9-16)12-39-22(37)20-19-18(41-24-35-7-8-36-24)11-25(34,21(19)20)23(38)40-13-15-4-2-6-17(10-15)27(31,32)33;/h1-7,9-10,18-21H,8,11-13,34H2;1H/t18-,19-,20-,21-,25-;/m0./s1 |
| InChIKey | XYZHDKMKTYXPKG-GISMJXMVSA-N |
| XLogP | 5.44 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.01 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |