C24H24N4O4S — CID 71140816
dibenzyl (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 71140816) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is dibenzyl (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | dibenzyl (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 71140816 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | dibenzyl (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | N[C@@]1(C(=O)OCc2ccccc2)C[C@H](Sc2ncn[nH]2)[C@H]2[C@H](C(=O)OCc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C24H24N4O4S/c25-24(22(30)32-13-16-9-5-2-6-10-16)11-17(33-23-26-14-27-28-23)18-19(20(18)24)21(29)31-12-15-7-3-1-4-8-15/h1-10,14,17-20H,11-13,25H2,(H,26,27,28)/t17-,18-,19-,20-,24-/m0/s1 |
| InChIKey | KAMXAYSXFKTSBQ-HPGFDKJQSA-N |
| XLogP | 2.72 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |