About N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine
N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine (PubChem CID 160691635) has the molecular formula C3H20N4Si4
and a molecular weight of 224.56 g/mol. Its IUPAC name is N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine.
Molecular Properties
| Compound Name | N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine |
| PubChem CID | 160691635 |
| Molecular Formula | C3H20N4Si4 |
| Molecular Weight | 224.56 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine |
| SMILES | NCN([SiH3])CN([SiH3])CN([SiH3])[SiH3] |
| InChI | InChI=1S/C3H20N4Si4/c4-1-5(8)2-6(9)3-7(10)11/h1-4H2,8-11H3 |
| InChIKey | RPMCBDNZKMBJHK-UHFFFAOYSA-N |
| XLogP | -6.15 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.56 |
| LogP ≤ 5 | -6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine?
The IUPAC name of N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine (CID 160691635) is N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine.
What is the SMILES notation for N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine?
The canonical SMILES for N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine is NCN([SiH3])CN([SiH3])CN([SiH3])[SiH3].
What is the InChIKey of N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine?
The InChIKey is RPMCBDNZKMBJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H20N4Si4/c4-1-5(8)2-6(9)3-7(10)11/h1-4H2,8-11H3.
What are the key properties of N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine?
N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine has a molecular weight of 224.56 g/mol, XLogP of -6.15, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[(disilylamino)methyl-silylamino]methyl]-N'-silylmethanediamine is sourced from PubChem (CID 160691635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).