About heptyl methyl phosphate;1-methoxybutane
heptyl methyl phosphate;1-methoxybutane (PubChem CID 160703471) has the molecular formula C13H30O5P-
and a molecular weight of 297.35 g/mol. Its IUPAC name is heptyl methyl phosphate;1-methoxybutane.
Molecular Properties
| Compound Name | heptyl methyl phosphate;1-methoxybutane |
| PubChem CID | 160703471 |
| Molecular Formula | C13H30O5P- |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | heptyl methyl phosphate;1-methoxybutane |
| SMILES | CCCCCCCOP(=O)([O-])OC.CCCCOC |
| InChI | InChI=1S/C8H19O4P.C5H12O/c1-3-4-5-6-7-8-12-13(9,10)11-2;1-3-4-5-6-2/h3-8H2,1-2H3,(H,9,10);3-5H2,1-2H3/p-1 |
| InChIKey | RQXMITOSOAUIPS-UHFFFAOYSA-M |
| XLogP | 3.52 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze heptyl methyl phosphate;1-methoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl methyl phosphate;1-methoxybutane?
The IUPAC name of heptyl methyl phosphate;1-methoxybutane (CID 160703471) is heptyl methyl phosphate;1-methoxybutane.
What is the SMILES notation for heptyl methyl phosphate;1-methoxybutane?
The canonical SMILES for heptyl methyl phosphate;1-methoxybutane is CCCCCCCOP(=O)([O-])OC.CCCCOC.
What is the InChIKey of heptyl methyl phosphate;1-methoxybutane?
The InChIKey is RQXMITOSOAUIPS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19O4P.C5H12O/c1-3-4-5-6-7-8-12-13(9,10)11-2;1-3-4-5-6-2/h3-8H2,1-2H3,(H,9,10);3-5H2,1-2H3/p-1.
What are the key properties of heptyl methyl phosphate;1-methoxybutane?
heptyl methyl phosphate;1-methoxybutane has a molecular weight of 297.35 g/mol, XLogP of 3.52, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl methyl phosphate;1-methoxybutane is sourced from PubChem (CID 160703471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).