C16H30FN4O15P3 — CID 160705119
[(2R,3S,4R,5R)-5-(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate;N,N-diethylethanamine (PubChem CID 160705119) has the molecular formula C16H30FN4O15P3 and a molecular weight of 630.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate;N,N-diethylethanamine.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 160705119 |
| Molecular Formula | C16H30FN4O15P3 |
| Molecular Weight | 630.35 g/mol |
| Exact Mass | 630.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.COP(=O)(O[C@H]1O[C@@H](n2cc(F)nc(C(N)=O)c2=O)[C@H](O)[C@@H]1O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H15FN3O15P3.C6H15N/c1-25-32(24,29-31(22,23)28-30(19,20)21)27-10-6(16)5(15)9(26-10)14-2-3(11)13-4(7(12)17)8(14)18;1-4-7(5-2)6-3/h2,5-6,9-10,15-16H,1H3,(H2,12,17)(H,22,23)(H2,19,20,21);4-6H2,1-3H3/t5-,6+,9-,10-,32?;/m1./s1 |
| InChIKey | RRCWTEKMWFMIDX-JQRJYKRTSA-N |
| XLogP | -0.60 |
| TPSA | 279.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.35 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|