C11H17N4O13P3 — CID 175675981
[(2R,3S,4R,5S)-5-(4-amino-7H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate (PubChem CID 175675981) has the molecular formula C11H17N4O13P3 and a molecular weight of 506.19 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-amino-7H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-amino-7H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate |
|---|---|
| PubChem CID | 175675981 |
| Molecular Formula | C11H17N4O13P3 |
| Molecular Weight | 506.19 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-amino-7H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] methyl phosphate |
| SMILES | COP(=O)(O[C@H]1O[C@@H](C2C=Nc3c(N)ncnc32)[C@H](O)[C@@H]1O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H17N4O13P3/c1-24-31(23,28-30(21,22)27-29(18,19)20)26-11-8(17)7(16)9(25-11)4-2-13-6-5(4)14-3-15-10(6)12/h2-4,7-9,11,16-17H,1H3,(H,21,22)(H2,12,14,15)(H2,18,19,20)/t4?,7-,8+,9+,11-,31?/m1/s1 |
| InChIKey | XYKVOLUTZXMXEO-UZOYFCMNSA-N |
| XLogP | -0.70 |
| TPSA | 262.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.19 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|