C9H17N3NaO16P3 — CID 165430234
sodium;6-amino-1H-pyrimidin-2-one;[hydroxy(phosphonooxy)phosphoryl] [(3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl] phosphate (PubChem CID 165430234) has the molecular formula C9H17N3NaO16P3 and a molecular weight of 539.15 g/mol. Its IUPAC name is sodium;6-amino-1H-pyrimidin-2-one;[hydroxy(phosphonooxy)phosphoryl] [(3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl] phosphate.
| Compound Name | sodium;6-amino-1H-pyrimidin-2-one;[hydroxy(phosphonooxy)phosphoryl] [(3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl] phosphate |
|---|---|
| PubChem CID | 165430234 |
| Molecular Formula | C9H17N3NaO16P3 |
| Molecular Weight | 539.15 g/mol |
| Exact Mass | 538.97 |
| IUPAC Name | sodium;6-amino-1H-pyrimidin-2-one;[hydroxy(phosphonooxy)phosphoryl] [(3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl] phosphate |
| SMILES | Nc1ccnc(=O)[nH]1.O=P(O)(O)OP(=O)(O)OP(=O)([O-])OC1OC(O)[C@@H](O)[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C5H13O15P3.C4H5N3O.Na/c6-1-2(7)4(9)17-5(3(1)8)18-22(13,14)20-23(15,16)19-21(10,11)12;5-3-1-2-6-4(8)7-3;/h1-9H,(H,13,14)(H,15,16)(H2,10,11,12);1-2H,(H3,5,6,7,8);/q;;+1/p-1/t1-,2-,3-,4?,5?;;/m0../s1 |
| InChIKey | SPXUREOIGHFOFK-XBRLBNOSSA-M |
| XLogP | -7.19 |
| TPSA | 324.57 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.15 |
| LogP ≤ 5 | -7.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|