C9H20N3O15P3 — CID 174839766
6-amino-1H-pyrimidin-2-one;diphosphono hydrogen phosphate;3,4,5-trihydroxypentanal (PubChem CID 174839766) has the molecular formula C9H20N3O15P3 and a molecular weight of 503.19 g/mol. Its IUPAC name is 6-amino-1H-pyrimidin-2-one;diphosphono hydrogen phosphate;3,4,5-trihydroxypentanal.
| Compound Name | 6-amino-1H-pyrimidin-2-one;diphosphono hydrogen phosphate;3,4,5-trihydroxypentanal |
|---|---|
| PubChem CID | 174839766 |
| Molecular Formula | C9H20N3O15P3 |
| Molecular Weight | 503.19 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | 6-amino-1H-pyrimidin-2-one;diphosphono hydrogen phosphate;3,4,5-trihydroxypentanal |
| SMILES | Nc1ccnc(=O)[nH]1.O=CCC(O)C(O)CO.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H10O4.C4H5N3O.H5O10P3/c6-2-1-4(8)5(9)3-7;5-3-1-2-6-4(8)7-3;1-11(2,3)9-13(7,8)10-12(4,5)6/h2,4-5,7-9H,1,3H2;1-2H,(H3,5,6,7,8);(H,7,8)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | DYWVXJYMOJPHKQ-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 320.35 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.19 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|