C13H21F2N3O8 — CID 175348395
6-amino-1H-pyrimidin-2-one;butanoic acid;(2S)-2-fluoro-2,3,4,5-tetrahydroxypentanoyl fluoride (PubChem CID 175348395) has the molecular formula C13H21F2N3O8 and a molecular weight of 385.32 g/mol. Its IUPAC name is 6-amino-1H-pyrimidin-2-one;butanoic acid;(2S)-2-fluoro-2,3,4,5-tetrahydroxypentanoyl fluoride.
| Compound Name | 6-amino-1H-pyrimidin-2-one;butanoic acid;(2S)-2-fluoro-2,3,4,5-tetrahydroxypentanoyl fluoride |
|---|---|
| PubChem CID | 175348395 |
| Molecular Formula | C13H21F2N3O8 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 6-amino-1H-pyrimidin-2-one;butanoic acid;(2S)-2-fluoro-2,3,4,5-tetrahydroxypentanoyl fluoride |
| SMILES | CCCC(=O)O.Nc1ccnc(=O)[nH]1.O=C(F)[C@@](O)(F)C(O)C(O)CO |
| InChI | InChI=1S/C5H8F2O5.C4H5N3O.C4H8O2/c6-4(11)5(7,12)3(10)2(9)1-8;5-3-1-2-6-4(8)7-3;1-2-3-4(5)6/h2-3,8-10,12H,1H2;1-2H,(H3,5,6,7,8);2-3H2,1H3,(H,5,6)/t2?,3?,5-;;/m1../s1 |
| InChIKey | RIMAZYFUYKRQEE-LGNSZICFSA-N |
| XLogP | -1.92 |
| TPSA | 207.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|